CAS 1307815-48-0 is the registry number for (E)-Ethyl 2-(ethoxymethylene)-4,4,4-trifluoro-3-oxobutanoate, 97%. Offered by: AmBeed. Available pack sizes: 25g.
Ethyl (2E)-2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate (CAS 1307815-48-0) is a chemical compound with the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. IUPAC name: ethyl (2E)-2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate. InChIKey: XNGGOXOLHQANRB-AATRIKPKSA-N.
| Molecular formula | C9H11F3O4 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | ethyl (2E)-2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate |
| InChIKey | XNGGOXOLHQANRB-AATRIKPKSA-N |
| SMILES | CCO/C=C(\C(=O)C(F)(F)F)/C(=O)OCC |
Computed by PubChem (NCBI)