Products 2649469-06-5
CAS 2649469-06-5 is the registry number for Ethyl 5-methyl-3-oxo-5-(trifluoromethyl)tetrahydrofuran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-methyl-3-oxo-5-(trifluoromethyl)oxolane-2-carboxylate (CAS 2649469-06-5) is a chemical compound with the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. IUPAC name: ethyl 5-methyl-3-oxo-5-(trifluoromethyl)oxolane-2-carboxylate. InChIKey: MWNKICLXZLJJMD-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O4 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | ethyl 5-methyl-3-oxo-5-(trifluoromethyl)oxolane-2-carboxylate |
| InChIKey | MWNKICLXZLJJMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)CC(O1)(C)C(F)(F)F |
Computed by PubChem (NCBI)