CAS 2879251-26-8 is the registry number for WIZ degrader 8. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
3-[6-[(3R,5R)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2879251-26-8) is a chemical compound with the molecular formula C21H27N3O4 and a molecular weight of 385.5 g/mol. IUPAC name: 3-[6-[(3R,5R)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: DADIMSMRMNXYMS-HZBOCPGUSA-N.
| Molecular formula | C21H27N3O4 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 3-[6-[(3R,5R)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | DADIMSMRMNXYMS-HZBOCPGUSA-N |
| SMILES | CCN1C[C@@H](C[C@H](C1)OC2=CC3=C(C=C2)C(=O)N(C3)C4CCC(=O)NC4=O)C |
Computed by PubChem (NCBI)