CAS 2881017-49-6 is the registry number for Blixeprodil. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-(4-fluorophenyl)-2-(methylamino)cyclohexan-1-one (CAS 2881017-49-6) is a chemical compound with the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. IUPAC name: (2R)-2-(4-fluorophenyl)-2-(methylamino)cyclohexan-1-one. InChIKey: GLHWPYBETIKGHM-CYBMUJFWSA-N.
| Molecular formula | C13H16FNO |
|---|---|
| Molecular weight | 221.27 g/mol |
| IUPAC name | (2R)-2-(4-fluorophenyl)-2-(methylamino)cyclohexan-1-one |
| InChIKey | GLHWPYBETIKGHM-CYBMUJFWSA-N |
| SMILES | CN[C@]1(CCCCC1=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)