CAS 288154-62-1 is the registry number for 1-(2-(2,4-Dichlorophenoxy)propionyl)-4-benzylthiosemicarbazide. Offered by: Biosynth. Available pack sizes: 10g, 25g.
1-benzyl-3-[2-(2,4-dichlorophenoxy)propanoylamino]thiourea (CAS 288154-62-1) is a chemical compound with the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.3 g/mol. IUPAC name: 1-benzyl-3-[2-(2,4-dichlorophenoxy)propanoylamino]thiourea. InChIKey: OZDOZUZCTZQUMQ-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2N3O2S |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 1-benzyl-3-[2-(2,4-dichlorophenoxy)propanoylamino]thiourea |
| InChIKey | OZDOZUZCTZQUMQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NNC(=S)NCC1=CC=CC=C1)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)