CAS 889593-61-7 is the registry number for 1-(2-(4-ethylphenoxy)acetyl)-4-(2,4-dichlorophenyl)thiosemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-(2,4-dichlorophenyl)-3-[[2-(4-ethylphenoxy)acetyl]amino]thiourea (CAS 889593-61-7) is a chemical compound with the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.3 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-3-[[2-(4-ethylphenoxy)acetyl]amino]thiourea. InChIKey: XAUUAILCAMBETA-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2N3O2S |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-3-[[2-(4-ethylphenoxy)acetyl]amino]thiourea |
| InChIKey | XAUUAILCAMBETA-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)OCC(=O)NNC(=S)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)