CAS 28819-38-7 is the registry number for 5-Pyridin-3-yl-1,3,4-thiadiazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-pyridin-3-yl-3H-1,3,4-thiadiazole-2-thione (CAS 28819-38-7) is a chemical compound with the molecular formula C7H5N3S2 and a molecular weight of 195.3 g/mol. IUPAC name: 5-pyridin-3-yl-3H-1,3,4-thiadiazole-2-thione. InChIKey: JKGZFPMDTJXQEC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3S2 |
|---|---|
| Molecular weight | 195.3 g/mol |
| IUPAC name | 5-pyridin-3-yl-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | JKGZFPMDTJXQEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NNC(=S)S2 |
Computed by PubChem (NCBI)