CAS 98273-53-1 is the registry number for 5-(Thiophen-2-yl)-1,2,4-triazine-3-thiol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-thiophen-2-yl-2H-1,2,4-triazine-3-thione (CAS 98273-53-1) is a chemical compound with the molecular formula C7H5N3S2 and a molecular weight of 195.3 g/mol. IUPAC name: 5-thiophen-2-yl-2H-1,2,4-triazine-3-thione. InChIKey: GMEFBTFURKGPRD-UHFFFAOYSA-N.
| Molecular formula | C7H5N3S2 |
|---|---|
| Molecular weight | 195.3 g/mol |
| IUPAC name | 5-thiophen-2-yl-2H-1,2,4-triazine-3-thione |
| InChIKey | GMEFBTFURKGPRD-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=S)NN=C2 |
Computed by PubChem (NCBI)