CAS 28832-58-8 appears in our catalog under these names: 1-[2-(5-Chloropyridin-2-yl)diazen-1-yl]naphthalen-2-ol, 95%, 1–(2–(5–chloropyridin–2–yl)diazen–1–yl)naphthalen–2–ol, 1-[2-(5-Chloro-2-pyridinyl)diazenyl]-2-naphthalenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg.
1-[(5-chloro-2-pyridinyl)diazenyl]naphthalen-2-ol (CAS 28832-58-8) is a chemical compound with the molecular formula C15H10ClN3O and a molecular weight of 283.71 g/mol. IUPAC name: 1-[(5-chloro-2-pyridinyl)diazenyl]naphthalen-2-ol. InChIKey: GLVGIWOEYVSICM-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3O |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 1-[(5-chloro-2-pyridinyl)diazenyl]naphthalen-2-ol |
| InChIKey | GLVGIWOEYVSICM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N=NC3=NC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)