Products 31709-27-0

CAS 31709-27-0 appears in our catalog under these names: Estazolam Impurity 1, Estazolam Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

[5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-phenylmethanone (CAS 31709-27-0) is a chemical compound with the molecular formula C15H10ClN3O and a molecular weight of 283.71 g/mol. IUPAC name: [5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-phenylmethanone. InChIKey: LLVFXKRKLRMCRG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10ClN3O
Molecular weight283.71 g/mol
IUPAC name[5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-phenylmethanone
InChIKeyLLVFXKRKLRMCRG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)N3C=NN=C3

Computed by PubChem (NCBI)