Products 2883421-73-4
CAS 2883421-73-4 is the registry number for 7-Chloro-8-(2-hydroxyethoxy)pyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-8-(2-hydroxyethoxy)-1H-pyrido[4,3-d]pyrimidine-2,4-dione (CAS 2883421-73-4) is a chemical compound with the molecular formula C9H8ClN3O4 and a molecular weight of 257.63 g/mol. IUPAC name: 7-chloro-8-(2-hydroxyethoxy)-1H-pyrido[4,3-d]pyrimidine-2,4-dione. InChIKey: MUDAGOVICQJQKO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O4 |
|---|---|
| Molecular weight | 257.63 g/mol |
| IUPAC name | 7-chloro-8-(2-hydroxyethoxy)-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| InChIKey | MUDAGOVICQJQKO-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=N1)Cl)OCCO)NC(=O)NC2=O |
Computed by PubChem (NCBI)