Products 899028-52-5
CAS 899028-52-5 is the registry number for Methyl chloro[(2-nitrophenyl)hydrazono]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Methyl (2Z)-2-chloro-2-[(2-nitrophenyl)hydrazinylidene]acetate (CAS 899028-52-5) is a chemical compound with the molecular formula C9H8ClN3O4 and a molecular weight of 257.63 g/mol. IUPAC name: methyl (2Z)-2-chloro-2-[(2-nitrophenyl)hydrazinylidene]acetate. InChIKey: MMNTWYIQEDRPRS-WQLSENKSSA-N.
| Molecular formula | C9H8ClN3O4 |
|---|---|
| Molecular weight | 257.63 g/mol |
| IUPAC name | methyl (2Z)-2-chloro-2-[(2-nitrophenyl)hydrazinylidene]acetate |
| InChIKey | MMNTWYIQEDRPRS-WQLSENKSSA-N |
| SMILES | COC(=O)/C(=N/NC1=CC=CC=C1[N+](=O)[O-])/Cl |
Computed by PubChem (NCBI)