Products 2883668-01-5
CAS 2883668-01-5 is the registry number for tert-Butyl 2-bromo-6,6-dimethyl-4-oxo-4,6-dihydro-5H-pyrrolo[3,4-d]thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-bromo-6,6-dimethyl-4-oxopyrrolo[3,4-d][1,3]thiazole-5-carboxylate (CAS 2883668-01-5) is a chemical compound with the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. IUPAC name: tert-butyl 2-bromo-6,6-dimethyl-4-oxopyrrolo[3,4-d][1,3]thiazole-5-carboxylate. InChIKey: XAOQHNDCSXDPLP-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3S |
|---|---|
| Molecular weight | 347.23 g/mol |
| IUPAC name | tert-butyl 2-bromo-6,6-dimethyl-4-oxopyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
| InChIKey | XAOQHNDCSXDPLP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=O)N1C(=O)OC(C)(C)C)N=C(S2)Br)C |
Computed by PubChem (NCBI)