CAS 2270911-65-2 is the registry number for 3-Bromo-5-cyclopropanesulfonylamino-n,n-dimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-bromo-5-(cyclopropylsulfonylamino)-N,N-dimethylbenzamide (CAS 2270911-65-2) is a chemical compound with the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. IUPAC name: 3-bromo-5-(cyclopropylsulfonylamino)-N,N-dimethylbenzamide. InChIKey: ZRQZHNIWQTZRRZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3S |
|---|---|
| Molecular weight | 347.23 g/mol |
| IUPAC name | 3-bromo-5-(cyclopropylsulfonylamino)-N,N-dimethylbenzamide |
| InChIKey | ZRQZHNIWQTZRRZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)NS(=O)(=O)C2CC2 |
Computed by PubChem (NCBI)