CAS 486422-26-8 is the registry number for 4-(4-Acetylpiperazinosulfonyl)bromobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethanone (CAS 486422-26-8) is a chemical compound with the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. IUPAC name: 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethanone. InChIKey: NBKDNKGVTSTVQZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3S |
|---|---|
| Molecular weight | 347.23 g/mol |
| IUPAC name | 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethanone |
| InChIKey | NBKDNKGVTSTVQZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)