CAS 28861-29-2 is the registry number for 1-Diazo-4-phenyl-3-butyn-2-one. Offered by: TRC. Available pack sizes: 50mg.
1-diazo-4-phenylbut-3-yn-2-one (CAS 28861-29-2) is a chemical compound with the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. IUPAC name: 1-diazo-4-phenylbut-3-yn-2-one. InChIKey: XVNUATUUQHXAPA-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 1-diazo-4-phenylbut-3-yn-2-one |
| InChIKey | XVNUATUUQHXAPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)