CAS 2888709-47-3 is the registry number for 2-(5-Oxo-4,5-dihydro-1H-pyrazol-3-yl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-oxo-1,4-dihydropyrazol-3-yl)isoindole-1,3-dione (CAS 2888709-47-3) is a chemical compound with the molecular formula C11H7N3O3 and a molecular weight of 229.19 g/mol. IUPAC name: 2-(5-oxo-1,4-dihydropyrazol-3-yl)isoindole-1,3-dione. InChIKey: DFHNYRDYMJUWJY-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O3 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 2-(5-oxo-1,4-dihydropyrazol-3-yl)isoindole-1,3-dione |
| InChIKey | DFHNYRDYMJUWJY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NN=C1N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)