CAS 869947-19-3 appears in our catalog under these names: 7-(Furan-2-yl)pyrazolo(1,5-a)pyrimidine-2-carboxylic acid, 97%, 7-Furan-2-yl-pyrazolo(1,5-a)pyrimidine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 869947-19-3) is a chemical compound with the molecular formula C11H7N3O3 and a molecular weight of 229.19 g/mol. IUPAC name: 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: WVANFBWIAZCONH-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O3 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | WVANFBWIAZCONH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=NC3=CC(=NN23)C(=O)O |
Computed by PubChem (NCBI)