CAS 289061-22-9 appears in our catalog under these names: N-(4-(((2-phenylethyl)amino)sulfonyl)phenyl)ethanamide, N-{4-[(2-phenylethyl)sulfamoyl]phenyl}acetamide, 96%, 96%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g.
N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide (CAS 289061-22-9) is a chemical compound with the molecular formula C16H18N2O3S and a molecular weight of 318.4 g/mol. IUPAC name: N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide. InChIKey: IXTPVFWNVNHEGT-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide |
| InChIKey | IXTPVFWNVNHEGT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)