CAS 499197-61-4 appears in our catalog under these names: 1-(2,4-Dimethylphenyl)-3-(4-methylbenzenesulfonyl)urea, 95%, ((2,4-dimethylphenyl)amino)-N-((4-methylphenyl)sulfonyl)formamide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg.
1-(2,4-dimethylphenyl)-3-(4-methylphenyl)sulfonylurea (CAS 499197-61-4) is a chemical compound with the molecular formula C16H18N2O3S and a molecular weight of 318.4 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-3-(4-methylphenyl)sulfonylurea. InChIKey: OBARWVNFIATNPJ-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | OBARWVNFIATNPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=C(C=C(C=C2)C)C |
Computed by PubChem (NCBI)