Products 2891580-04-2
CAS 2891580-04-2 is the registry number for (2R,6S)-2-ethyl-6-methylpiperazine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R,6S)-2-ethyl-6-methylpiperazine;dihydrochloride (CAS 2891580-04-2) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (2R,6S)-2-ethyl-6-methylpiperazine;dihydrochloride. InChIKey: SMMWSURSIQTWBY-AUCRBCQYSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (2R,6S)-2-ethyl-6-methylpiperazine;dihydrochloride |
| InChIKey | SMMWSURSIQTWBY-AUCRBCQYSA-N |
| SMILES | CC[C@@H]1CNC[C@@H](N1)C.Cl.Cl |
Computed by PubChem (NCBI)