Products 2920207-79-8
CAS 2920207-79-8 is the registry number for (2S,6R)-2-ethyl-6-methyl-piperazine dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,6R)-2-ethyl-6-methylpiperazine;dihydrochloride (CAS 2920207-79-8) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (2S,6R)-2-ethyl-6-methylpiperazine;dihydrochloride. InChIKey: SMMWSURSIQTWBY-VJBFUYBPSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (2S,6R)-2-ethyl-6-methylpiperazine;dihydrochloride |
| InChIKey | SMMWSURSIQTWBY-VJBFUYBPSA-N |
| SMILES | CC[C@H]1CNC[C@H](N1)C.Cl.Cl |
Computed by PubChem (NCBI)