CAS 2891598-50-6 is the registry number for 1-(benzenesulfonyl)-6-chloro-2-ethyl-pyrrolo[2,3-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-6-chloro-2-ethylpyrrolo[2,3-b]pyridine (CAS 2891598-50-6) is a chemical compound with the molecular formula C15H13ClN2O2S and a molecular weight of 320.8 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-chloro-2-ethylpyrrolo[2,3-b]pyridine. InChIKey: SYMAHABHNHBEAS-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2S |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-chloro-2-ethylpyrrolo[2,3-b]pyridine |
| InChIKey | SYMAHABHNHBEAS-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(N1S(=O)(=O)C3=CC=CC=C3)N=C(C=C2)Cl |
Computed by PubChem (NCBI)