CAS 869335-18-2 appears in our catalog under these names: 4-Chloro-3-methyl-1-tosyl-1H-pyrrolo(2,3-b)pyridine, 97%, 4-Chloro-3-methyl-1-tosyl-1H-pyrrolo[2,3-b]pyridine, 95%, 95%, 4-Chloro-3-methyl-1-tosyl-1H-pyrrolo[2,3-b]pyridine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 50mg, 500mg.
4-chloro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 869335-18-2) is a chemical compound with the molecular formula C15H13ClN2O2S and a molecular weight of 320.8 g/mol. IUPAC name: 4-chloro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: YBJUYMVPMWMUQJ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2S |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | 4-chloro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | YBJUYMVPMWMUQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C(C=CN=C32)Cl)C |
Computed by PubChem (NCBI)