Products 2891599-50-9
CAS 2891599-50-9 is the registry number for 5-nitro-6-(trifluoromethyl)indoline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-nitro-6-(trifluoromethyl)-2,3-dihydro-1H-indole (CAS 2891599-50-9) is a chemical compound with the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. IUPAC name: 5-nitro-6-(trifluoromethyl)-2,3-dihydro-1H-indole. InChIKey: KRMFQTOKLFSHBJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O2 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | 5-nitro-6-(trifluoromethyl)-2,3-dihydro-1H-indole |
| InChIKey | KRMFQTOKLFSHBJ-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)