Products 459191-31-2
CAS 459191-31-2 is the registry number for 8-Amino-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-amino-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 459191-31-2) is a chemical compound with the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. IUPAC name: 8-amino-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: TWGPRVZKUXCWRK-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O2 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | 8-amino-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | TWGPRVZKUXCWRK-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=CC(=C2O1)N)C(F)(F)F |
Computed by PubChem (NCBI)