Products 28917-17-1
CAS 28917-17-1 appears in our catalog under these names: 3-Phenyl-5-vinyl-1,2,4-oxadiazole, >95% (HPLC), 5-Ethenyl-3-phenyl-1,2,4-oxadiazole, 95% +(stabilized with TBC), 5-Ethenyl-3-phenyl-1,2,4-oxadiazole. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 10mg, 5g, 0,05g, 0,1g, 0,25g, 0,5g, 1g.
5-ethenyl-3-phenyl-1,2,4-oxadiazole (CAS 28917-17-1) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 5-ethenyl-3-phenyl-1,2,4-oxadiazole. InChIKey: WSTDQQDNFXEASU-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 5-ethenyl-3-phenyl-1,2,4-oxadiazole |
| InChIKey | WSTDQQDNFXEASU-UHFFFAOYSA-N |
| SMILES | C=CC1=NC(=NO1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)