CAS 28917-82-0 appears in our catalog under these names: Calcium glycerophosphate hydrate, 95%, Calcium 2,3-dihydroxypropyl phosphate hydrate, 97%, Calcium glycerophosphate hydrate, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 100g, 5g, 1000g, 250g.
Calcium;2,3-dihydroxypropyl phosphate;hydrate (CAS 28917-82-0) is a chemical compound with the molecular formula C3H9CaO7P and a molecular weight of 228.15 g/mol. IUPAC name: calcium;2,3-dihydroxypropyl phosphate;hydrate. InChIKey: ILSFDSREGJGPRB-UHFFFAOYSA-L.
| Molecular formula | C3H9CaO7P |
|---|---|
| Molecular weight | 228.15 g/mol |
| IUPAC name | calcium;2,3-dihydroxypropyl phosphate;hydrate |
| InChIKey | ILSFDSREGJGPRB-UHFFFAOYSA-L |
| SMILES | C(C(COP(=O)([O-])[O-])O)O.O.[Ca+2] |
Computed by PubChem (NCBI)