CAS 398143-83-4 is the registry number for Glycerol Phosphate Calcium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Calcium;2,3-dihydroxypropyl phosphate;hydrate (CAS 398143-83-4) is a chemical compound with the molecular formula C3H9CaO7P and a molecular weight of 228.15 g/mol. IUPAC name: calcium;2,3-dihydroxypropyl phosphate;hydrate. InChIKey: ILSFDSREGJGPRB-UHFFFAOYSA-L.
| Molecular formula | C3H9CaO7P |
|---|---|
| Molecular weight | 228.15 g/mol |
| IUPAC name | calcium;2,3-dihydroxypropyl phosphate;hydrate |
| InChIKey | ILSFDSREGJGPRB-UHFFFAOYSA-L |
| SMILES | C(C(COP(=O)([O-])[O-])O)O.O.[Ca+2] |
Computed by PubChem (NCBI)