CAS 2891993-43-2 is the registry number for tert-Butyl (3-cyano-4-oxo-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-cyano-4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)carbamate (CAS 2891993-43-2) is a chemical compound with the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. IUPAC name: tert-butyl N-(3-cyano-4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)carbamate. InChIKey: MNCAOBOFGNTTSB-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3S |
|---|---|
| Molecular weight | 292.36 g/mol |
| IUPAC name | tert-butyl N-(3-cyano-4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)carbamate |
| InChIKey | MNCAOBOFGNTTSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C2=C(S1)CCCC2=O)C#N |
Computed by PubChem (NCBI)