CAS 2891993-63-6 is the registry number for 8-Bromo-9H-imidazo[1,2-a]indol-9-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromoimidazo[1,2-a]indol-4-one (CAS 2891993-63-6) is a chemical compound with the molecular formula C10H5BrN2O and a molecular weight of 249.06 g/mol. IUPAC name: 5-bromoimidazo[1,2-a]indol-4-one. InChIKey: XPQDGZZFWBRGGB-UHFFFAOYSA-N.
| Molecular formula | C10H5BrN2O |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 5-bromoimidazo[1,2-a]indol-4-one |
| InChIKey | XPQDGZZFWBRGGB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)C3=NC=CN23 |
Computed by PubChem (NCBI)