CAS 28958-85-2 appears in our catalog under these names: Pilocarpine EP Impurity A HCl (Isopilocarpine HCl), Isopilocarpine Hydrochloride, >95% (HPLC), (3R,4R)-3-Ethyl-4-((1-methyl-1H-imidazol-5-yl)methyl)dihydrofuran-2(3H)-one Hydrochloride (Isopilocarpine Hydrochloride), Isopilocarpine hydrochloride, 99%, 99%. Offered by: Chemat Brand, TRC, Mikromol, Chemat. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 100mg.
(3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one;hydrochloride (CAS 28958-85-2) is a chemical compound with the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. IUPAC name: (3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one;hydrochloride. InChIKey: RNAICSBVACLLGM-KXNXZCPBSA-N.
| Molecular formula | C11H17ClN2O2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | (3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one;hydrochloride |
| InChIKey | RNAICSBVACLLGM-KXNXZCPBSA-N |
| SMILES | CC[C@@H]1[C@H](COC1=O)CC2=CN=CN2C.Cl |
Computed by PubChem (NCBI)