CAS 2896084-06-1 is the registry number for tert-Butyl 2-acetyl-5-(2,2,2-trifluoroethyl)-1H-pyrrole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-acetyl-5-(2,2,2-trifluoroethyl)pyrrole-1-carboxylate (CAS 2896084-06-1) is a chemical compound with the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. IUPAC name: tert-butyl 2-acetyl-5-(2,2,2-trifluoroethyl)pyrrole-1-carboxylate. InChIKey: PATPJYCUROMYOD-UHFFFAOYSA-N.
| Molecular formula | C13H16F3NO3 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | tert-butyl 2-acetyl-5-(2,2,2-trifluoroethyl)pyrrole-1-carboxylate |
| InChIKey | PATPJYCUROMYOD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(N1C(=O)OC(C)(C)C)CC(F)(F)F |
Computed by PubChem (NCBI)