CAS 873455-96-0 is the registry number for 4-(2,2-Dimethyl-1,3-dioxolan-4-ylmethoxy)-2-trifluoromethyl-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-(trifluoromethyl)aniline (CAS 873455-96-0) is a chemical compound with the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. IUPAC name: 4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-(trifluoromethyl)aniline. InChIKey: BLTXCXTXGOKTDQ-UHFFFAOYSA-N.
| Molecular formula | C13H16F3NO3 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | 4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-(trifluoromethyl)aniline |
| InChIKey | BLTXCXTXGOKTDQ-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)COC2=CC(=C(C=C2)N)C(F)(F)F)C |
Computed by PubChem (NCBI)