CAS 289654-66-6 is the registry number for ethyl 2–chloro–5–fluoroquinoline–3–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Ethyl 2-chloro-5-fluoroquinoline-3-carboxylate (CAS 289654-66-6) is a chemical compound with the molecular formula C12H9ClFNO2 and a molecular weight of 253.65 g/mol. IUPAC name: ethyl 2-chloro-5-fluoroquinoline-3-carboxylate. InChIKey: AQDSJAXDYWKFRB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO2 |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | ethyl 2-chloro-5-fluoroquinoline-3-carboxylate |
| InChIKey | AQDSJAXDYWKFRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=CC=C(C2=C1)F)Cl |
Computed by PubChem (NCBI)