CAS 2921728-55-2 is the registry number for 7-(Chloromethyl)-6-fluoro-3,5-dihydrofuro[3,2-c]quinolin-4(2H)-one 95%. Offered by: Ambeed. Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one (CAS 2921728-55-2) is a chemical compound with the molecular formula C12H9ClFNO2 and a molecular weight of 253.65 g/mol. IUPAC name: 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one. InChIKey: ZIBFHVYNMRGOEA-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO2 |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one |
| InChIKey | ZIBFHVYNMRGOEA-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C(=O)NC3=C2C=CC(=C3F)CCl |
Computed by PubChem (NCBI)