CAS 2897-00-9 appears in our catalog under these names: Prazepam EP Impurity B, 2-Cyclopropylmethylamino-5-chlorobenzophenone, (5-Chloro-2-((cyclopropylmethyl)amino)phenyl)phenylmethanone. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 25mg.
[5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone (CAS 2897-00-9) is a chemical compound with the molecular formula C17H16ClNO and a molecular weight of 285.8 g/mol. IUPAC name: [5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone. InChIKey: WCRKZICZCPHVAB-UHFFFAOYSA-N.
| Molecular formula | C17H16ClNO |
|---|---|
| Molecular weight | 285.8 g/mol |
| IUPAC name | [5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone |
| InChIKey | WCRKZICZCPHVAB-UHFFFAOYSA-N |
| SMILES | C1CC1CNC2=C(C=C(C=C2)Cl)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)