CAS 65621-78-5 appears in our catalog under these names: Asenapine Impurity 5 (Cis-Asenapine), Cis-Asenapine. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(2R,6S)-9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene (CAS 65621-78-5) is a chemical compound with the molecular formula C17H16ClNO and a molecular weight of 285.8 g/mol. IUPAC name: (2R,6S)-9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene. InChIKey: VSWBSWWIRNCQIJ-LSDHHAIUSA-N.
| Molecular formula | C17H16ClNO |
|---|---|
| Molecular weight | 285.8 g/mol |
| IUPAC name | (2R,6S)-9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene |
| InChIKey | VSWBSWWIRNCQIJ-LSDHHAIUSA-N |
| SMILES | CN1C[C@@H]2[C@H](C1)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C24 |
Computed by PubChem (NCBI)