CAS 2899-29-8 appears in our catalog under these names: H–Tryptophanol, L-Tryptophanol, 97% , L-Tryptophanol, L-(-)-Tryptophanol, >97.0%(T), L-Trp-ol 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 2g, 250mg, 25g, 100g, 100mg, 10g.
(2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol (CAS 2899-29-8) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol. InChIKey: UDQCRUSSQAXPJY-VIFPVBQESA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol |
| InChIKey | UDQCRUSSQAXPJY-VIFPVBQESA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](CO)N |
Computed by PubChem (NCBI)