CAS 52485-52-6 appears in our catalog under these names: D–Tryptophanol, D-Tryptophanol*HCl, D-Tryptophanol, D-Trp-ol 98%, D-TRYPTOPHANOL, 97%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 100mg.
(2R)-2-amino-3-(1H-indol-3-yl)propan-1-ol (CAS 52485-52-6) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: (2R)-2-amino-3-(1H-indol-3-yl)propan-1-ol. InChIKey: UDQCRUSSQAXPJY-SECBINFHSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (2R)-2-amino-3-(1H-indol-3-yl)propan-1-ol |
| InChIKey | UDQCRUSSQAXPJY-SECBINFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](CO)N |
Computed by PubChem (NCBI)