Products 2899343-54-3
CAS 2899343-54-3 is the registry number for 1-(5-Fluoro-3-(trifluoromethyl)pyridin-2-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[5-fluoro-3-(trifluoromethyl)-2-pyridinyl]ethanol (CAS 2899343-54-3) is a chemical compound with the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. IUPAC name: 1-[5-fluoro-3-(trifluoromethyl)-2-pyridinyl]ethanol. InChIKey: INNDHMAGQXRYHV-UHFFFAOYSA-N.
| Molecular formula | C8H7F4NO |
|---|---|
| Molecular weight | 209.14 g/mol |
| IUPAC name | 1-[5-fluoro-3-(trifluoromethyl)-2-pyridinyl]ethanol |
| InChIKey | INNDHMAGQXRYHV-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=N1)F)C(F)(F)F)O |
Computed by PubChem (NCBI)