Products 2901065-44-7

CAS 2901065-44-7 is the registry number for 4-Fluoro-2-isobutoxy-5-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-5-methyl-2-(2-methylpropoxy)benzoic acid (CAS 2901065-44-7) is a chemical compound with the molecular formula C12H15FO3 and a molecular weight of 226.24 g/mol. IUPAC name: 4-fluoro-5-methyl-2-(2-methylpropoxy)benzoic acid. InChIKey: KQZKJUNOWJDBCT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15FO3
Molecular weight226.24 g/mol
IUPAC name4-fluoro-5-methyl-2-(2-methylpropoxy)benzoic acid
InChIKeyKQZKJUNOWJDBCT-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1F)OCC(C)C)C(=O)O

Computed by PubChem (NCBI)