Products 2901082-32-2
CAS 2901082-32-2 is the registry number for 3,4'-dimethoxy-[1,1'-biphenyl]-4-carbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methoxy-4-(4-methoxyphenyl)benzaldehyde (CAS 2901082-32-2) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-methoxy-4-(4-methoxyphenyl)benzaldehyde. InChIKey: SEYVWWBGUDHJEW-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-methoxy-4-(4-methoxyphenyl)benzaldehyde |
| InChIKey | SEYVWWBGUDHJEW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)