Products 2901083-24-5
CAS 2901083-24-5 is the registry number for 1-(4-Bromo-2,5-dimethylphenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2,5-dimethylphenyl)cyclobutan-1-ol (CAS 2901083-24-5) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 1-(4-bromo-2,5-dimethylphenyl)cyclobutan-1-ol. InChIKey: AFWVRTSXAUIPCA-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(4-bromo-2,5-dimethylphenyl)cyclobutan-1-ol |
| InChIKey | AFWVRTSXAUIPCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C2(CCC2)O |
Computed by PubChem (NCBI)