CAS 2901086-16-4 appears in our catalog under these names: 1-([1,1'-Biphenyl]-4-yl(4-fluorophenyl)methyl)-1H-imidazole, 95%, 1-([1,1'-Biphenyl]-4-yl(4-fluorophenyl)methyl)-1H-imidazole, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-[(4-fluorophenyl)-(4-phenylphenyl)methyl]imidazole (CAS 2901086-16-4) is a chemical compound with the molecular formula C22H17FN2 and a molecular weight of 328.4 g/mol. IUPAC name: 1-[(4-fluorophenyl)-(4-phenylphenyl)methyl]imidazole. InChIKey: QWHUCSFBPZLRGD-UHFFFAOYSA-N.
| Molecular formula | C22H17FN2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)-(4-phenylphenyl)methyl]imidazole |
| InChIKey | QWHUCSFBPZLRGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=C(C=C3)F)N4C=CN=C4 |
Computed by PubChem (NCBI)