CAS 2901106-69-0 appears in our catalog under these names: 1-([1,1'-Biphenyl]-4-yl(2-fluorophenyl)methyl)-1H-imidazole, 95%, 95%, 1-([1,1'-Biphenyl]-4-yl(2-fluorophenyl)methyl)-1H-imidazole, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-[(2-fluorophenyl)-(4-phenylphenyl)methyl]imidazole (CAS 2901106-69-0) is a chemical compound with the molecular formula C22H17FN2 and a molecular weight of 328.4 g/mol. IUPAC name: 1-[(2-fluorophenyl)-(4-phenylphenyl)methyl]imidazole. InChIKey: MQMNUYIINCDRHY-UHFFFAOYSA-N.
| Molecular formula | C22H17FN2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)-(4-phenylphenyl)methyl]imidazole |
| InChIKey | MQMNUYIINCDRHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3F)N4C=CN=C4 |
Computed by PubChem (NCBI)