Products 2901103-06-6
CAS 2901103-06-6 is the registry number for tert-Butyl (4-bromobenzyl)(phenyl)carbamate, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl N-[(4-bromophenyl)methyl]-N-phenylcarbamate (CAS 2901103-06-6) is a chemical compound with the molecular formula C18H20BrNO2 and a molecular weight of 362.3 g/mol. IUPAC name: tert-butyl N-[(4-bromophenyl)methyl]-N-phenylcarbamate. InChIKey: MFMQOZNXDYWFTB-UHFFFAOYSA-N.
| Molecular formula | C18H20BrNO2 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | tert-butyl N-[(4-bromophenyl)methyl]-N-phenylcarbamate |
| InChIKey | MFMQOZNXDYWFTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC=C(C=C1)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)