CAS 432496-28-1 is the registry number for N-(4-Bromo-2-methylphenyl)-2-(4-isopropylphenoxy)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(4-bromo-2-methylphenyl)-2-(4-propan-2-ylphenoxy)acetamide (CAS 432496-28-1) is a chemical compound with the molecular formula C18H20BrNO2 and a molecular weight of 362.3 g/mol. IUPAC name: N-(4-bromo-2-methylphenyl)-2-(4-propan-2-ylphenoxy)acetamide. InChIKey: PTQIAMFFOFCBQH-UHFFFAOYSA-N.
| Molecular formula | C18H20BrNO2 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | N-(4-bromo-2-methylphenyl)-2-(4-propan-2-ylphenoxy)acetamide |
| InChIKey | PTQIAMFFOFCBQH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)NC(=O)COC2=CC=C(C=C2)C(C)C |
Computed by PubChem (NCBI)