CAS 2901109-95-1 is the registry number for 2,6-dichloro-3-(methylthio)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dichloro-3-methylsulfanylbenzaldehyde (CAS 2901109-95-1) is a chemical compound with the molecular formula C8H6Cl2OS and a molecular weight of 221.10 g/mol. IUPAC name: 2,6-dichloro-3-methylsulfanylbenzaldehyde. InChIKey: QVCBUDNMXYDDBU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2OS |
|---|---|
| Molecular weight | 221.10 g/mol |
| IUPAC name | 2,6-dichloro-3-methylsulfanylbenzaldehyde |
| InChIKey | QVCBUDNMXYDDBU-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)Cl)C=O)Cl |
Computed by PubChem (NCBI)