Products 35061-13-3
CAS 35061-13-3 appears in our catalog under these names: 1,3-Dichloro-4,5,6,7-tetrahydro-2-benzothiophen-4-one, 95%, 1,3-Dichloro-4,5,6,7-tetrahydro-2-benzothiophen-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-one (CAS 35061-13-3) is a chemical compound with the molecular formula C8H6Cl2OS and a molecular weight of 221.10 g/mol. IUPAC name: 1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-one. InChIKey: ZNWYWECRFKSGNU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2OS |
|---|---|
| Molecular weight | 221.10 g/mol |
| IUPAC name | 1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-one |
| InChIKey | ZNWYWECRFKSGNU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(SC(=C2C(=O)C1)Cl)Cl |
Computed by PubChem (NCBI)